
What are Schiff bases definition formation mechanism and applications
What is Schiff Base?
Schiff bases are condensation products of main amines with carbonyl compounds attaining significance day by day in the present scenario. Schiff bases are the compounds passing on imine or azomethine (– C=N–) functional groups and are known to be a flexible pharmacophore for the plan and improvement of different bioactive lead compounds. Schiff bases show valuable organic activities, for example, anti-inflammatory, pain-relieving, antimicrobial, anticonvulsant, antitubercular, anticancer, cancer prevention agent, anthelmintic, and antiglycation activities. Schiff bases are also appointed in the use of catalysts, pigments and dyes, intermediates in organic synthesis, polymer stabilizers, and corrosion inhibitors. The current review summarizes information on the diverse biological activities and also climaxes the recently synthesized several Schiff bases as potential bioactive cores.
Schiff's Base Reaction
The Schiff's base reaction is a group-specified reaction for aldehydes. The basic condition for the reaction to occur is a basic medium with aromatic amines to form a Schiff's base. Aniline is usually used to form a coloured anil or Schiff's base with an aldehyde. Carbohydrates can be envisioned with 4-aminobenzoic acid with the formation of coloured and fluorescent Schiff's bases. A very similar reaction takes place with 2-aminobiphenyl for aldehyde detection. One of the most subtle reagents for reducing sugar visualization, the aniline phthalate reagent, is also a Schiff's base reaction. The limit of sensitivity is 10 μg per chromatographic zone.
(Image to be added soon)
Structure Schiff Base
A Schiff base is a multifaceted with the general structure R2C=NR‘ and is measured as subclasses of imines, being either subordinate aldehydes or secondary keto-amines reliant on their structure. The term is usually used as a synonym to azomethine (which refers to secondary aldimines). These compounds are named after the Italian chemist Hugo Schiff. Various systems exist for the nomenclature of these compounds.
(Image to be added soon)
The general structure of a Schiff Base
Schiff bases are aldehyde- or ketone complexes where the carbonyl group is substituted by an azomethine or imine group. These are commonly used for industrial resolutions and also display a wide range of biological activities. These are the most extensively used organic compounds which are used as intermediates in organic synthesis, catalysts, pigments and dyes, polymer stabilizers, etc.
Synthesis of Schiff Bases
Schiff bases are characteristically formed by the condensation of a primary amine and an aldehyde which involves the usage of organic solvents such as methanol, tetrahydrofuran (THF), and 1,2-dichloroethane (DCE). Microwave-assisted preparation of a series of Schiff bases deprived of solvent has also been reported. Contrast of the three ways to synthesize simple Schiff base has been made and microwave irradiation was found to be the simplest way to synthesize the Schiff base.
Hydrolysis of Schiff Bases
Schiff base (imine) formation and hydrolysis are highly significant in biological chemistry. Many enzymes employ imines as part of their reaction mechanisms. An important biological reaction is the formation of an imine bond between an amino acid carbonyl group and the amine of the amino acid lysine.
This is due to the reason of their high reactivity and the ability to form adducts with other molecules. An adduct is the product of two molecules (in this case, one of which is the imine) that results in a single species. This adduction allows the molecule to experience the reactive effect of the imine. Imines are reactive because of their ability to act as electron ‘sinks’.
The nitrogen of the C=N bond is readily protonated, yielding a protonated imine. This serves as an electron-accepting group, which, when present in an adduct, can pull electrons away from the bonds in the attached molecule. This facilitates bond cleavage, which is an essential part of many metabolic reactions, for example, in glycolysis and amino acid metabolism.
Another crucial feature of imines, which has fuelled their biological relevance, is their ability to tautomerism, arranging the position of their proton and double bond, which also facilitates bond cleavage. The intermediate is called the iminium ion, and the resulting tautomer is called an enamine. This allows for regeneration of the imine and subsequent release of the adduct following hydrolysis.
Applications of Schiff Bases
Antimalarial Activity
Malaria is a chronic disease which was neglected for many years. Every year, nearly 500 million people are affected by this disease and approximately 1-3 million people die among them. Schiff bases are proved to be a very good source for the design of antimalarial agents. Schiff Base 5 was the most effective antimalarial agent among the other synthesized bases.
Antibacterial Activity
Bacteria is the root cause of many infectious diseases and responsible for an increase in the mortality rate. There are different kinds of bacteria and they exhibit a lot of resistance to antibiotics. Schiff bases have emerged as promising antibacterial agents. For example, Mycobacterium can be effectively treated with N- (salicylidene) -2- hydroxyaniline.
Antifungal Activity
Schiff bases with a 2,4-dichloro-5-fluorophenyl moiety have been proven to restrict the growth of fungi like Aspergillus flavus, Aspergillus fumigatus, Trichophyton mentagrophytes, and Penicillium marneffei.
Schiff Base Complexes As Catalysts
Many Schiff base complexes of metal ions show high catalytic activity and play a significant role in various reactions to enhance their yield and product selectivity. The convenient route of synthesis and thermal stability of Schiff base ligands have contributed significantly for their possible applications in catalysis as metal complexes
Schiff base complexes of transition metal ions are efficient catalysts for both homogeneous and heterogeneous reactions and the activity of these complexes varies with the type of ligands, coordination sites and metal ions. Chiral Schiff base complexes are more choosy in various reactions such as oxidation, hydroxylation, aldol condensation and epoxidation.
FAQs on Schiff Bases in Organic Chemistry Structure and Mechanism
1. What are Schiff bases in chemistry?
Schiff bases are organic compounds containing a characteristic imine group (–C=N–) formed by the condensation of a primary amine with an aldehyde or ketone. They are also called azomethines.
- General structure: R–CH=N–R′
- Formed by reaction of a primary amine (R–NH2) with a carbonyl compound.
- Named after the chemist Hugo Schiff.
- Widely used in coordination chemistry, medicinal chemistry, and organic synthesis.
2. How are Schiff bases formed?
Schiff bases are formed by a condensation reaction between a primary amine and an aldehyde or ketone, producing an imine and water.
- Step 1: Nucleophilic addition of R–NH2 to the carbonyl carbon.
- Step 2: Formation of a carbinolamine intermediate.
- Step 3: Elimination of water (dehydration) to form the C=N bond.
C6H5CHO + C6H5NH2 → C6H5CH=NC6H5 + H2O
(Benzaldehyde + aniline → benzylideneaniline + water)
3. What is the general formula of a Schiff base?
The general formula of a Schiff base is R–CH=N–R′, where R and R′ are alkyl or aryl groups and the key functional group is the imine (–C=N–).
- Derived from aldehydes: R–CH=N–R′
- Derived from ketones: R2C=N–R′
- Contains a carbon–nitrogen double bond.
4. What is the difference between an imine and a Schiff base?
An imine is any compound containing a C=N group, while a Schiff base is a specific type of imine formed from a primary amine and an aldehyde or ketone.
- Imine: General term for compounds with a carbon–nitrogen double bond.
- Schiff base: Imine where nitrogen is attached to an alkyl or aryl group (not hydrogen).
- All Schiff bases are imines, but not all imines are Schiff bases.
5. Why are Schiff bases important in coordination chemistry?
Schiff bases are important in coordination chemistry because they act as multidentate ligands that form stable metal complexes.
- The nitrogen atom of the C=N group donates a lone pair to metal ions.
- Often contain additional donor atoms such as O or S.
- Form chelate complexes with metals like Cu2+, Ni2+, Co2+, and Fe3+.
6. Can you give an example of a Schiff base reaction?
A common example of a Schiff base reaction is the condensation of salicylaldehyde with ethylenediamine to form a bis‑imine ligand.
Balanced reaction:
2C6H4(OH)CHO + H2NCH2CH2NH2 → C6H4(OH)CH=NCH2CH2N=CHC6H4(OH) + 2H2O
- Forms a tetradentate Schiff base ligand.
- Commonly used to prepare metal complexes.
7. What are the properties of Schiff bases?
Schiff bases are typically crystalline compounds containing a reactive imine (C=N) group with moderate polarity.
- Contain a polar azomethine linkage.
- Often colored due to conjugation.
- Undergo hydrolysis back to amine and carbonyl compound in acidic medium.
- Act as ligands due to lone pair on nitrogen.
8. Are Schiff bases stable in water?
Schiff bases are generally unstable in acidic aqueous conditions and can hydrolyze back to the original amine and carbonyl compound.
Hydrolysis reaction (reverse process):
R–CH=N–R′ + H2O → R–CHO + R′–NH2
- Stable under neutral or slightly basic conditions.
- Hydrolysis is faster in acidic medium.
- Conjugated or aromatic Schiff bases are more stable.
9. What are the applications of Schiff bases?
Schiff bases are used in medicinal chemistry, catalysis, analytical chemistry, and coordination chemistry.
- Metal complexes: Catalysts in oxidation and polymerization reactions.
- Medicinal uses: Antibacterial, antifungal, and anticancer studies.
- Analytical chemistry: Detection and estimation of metal ions.
- Biochemistry: Formation of imine intermediates in enzyme reactions.
10. What is the mechanism of Schiff base formation?
The mechanism of Schiff base formation involves nucleophilic addition of a primary amine to a carbonyl group followed by dehydration to form an imine.
- Step 1: Nucleophilic attack of amine on carbonyl carbon.
- Step 2: Formation of a tetrahedral carbinolamine intermediate.
- Step 3: Proton transfer and elimination of water.
- Step 4: Formation of the C=N double bond.






















