Courses
Courses for Kids
Free study material
Offline Centres
More
Store Icon
Store
seo-qna
SearchIcon
banner

What is the balanced equation for the combustion of pentane gas (C5H12)?

Answer
VerifiedVerified
447.6k+ views
like imagedislike image
Hint: Combustion means the compound is heated and there is the release of energy. The combustion of pentane gas means the reactants will be pentane and oxygen so, the products will be carbon dioxide gas and water.

Complete answer:
A balanced equation means the numbers of atoms on the reactant side are equal to the number of atoms on the product side. Combustion means the compounds are heated and there is the release of energy and for the combustion oxygen is an important element used.
Pentane is a compound of group alkane in which there are 5 carbon atoms, so its formula is C5H12. The combustion of pentane gas means the reactants will be pentane and oxygen so, the products will be carbon dioxide gas and water. The unbalanced reaction of combustion is given below:
C5H12+O2CO2+H2O
Now, we have to balance the reaction, the number of carbon atoms on the reactant side is 5 and the number of carbon atoms on the product side is 1, so we can multiply the carbon dioxide by 5. The reaction will be:
C5H12+O25CO2+H2O
There are 12 hydrogen atoms on the reactant side while there are 2 hydrogen atoms on the product side. So, we can multiply the water molecule by 6. The reaction will be:
C5H12+O25CO2+6H2O
There are 2 oxygen atoms on the reactant side while there are 16 oxygen atoms on the product side. So, we can multiply the oxygen molecule by 8. The reaction will be:
C5H12+8O25CO2+6H2O
This is the balanced reaction of the combustion of pentane gas.

Note:
We can also find the direct method to find the balanced equation for the combustion of any alkane. The reaction is:
CnH2n+2+(3n+12)O2nCO2+(n+1)H2O
For pentane, the value of n is 5.
Latest Vedantu courses for you
Grade 11 Science PCM | CBSE | SCHOOL | English
CBSE (2025-26)
calendar iconAcademic year 2025-26
language iconENGLISH
book iconUnlimited access till final school exam
tick
School Full course for CBSE students
PhysicsPhysics
ChemistryChemistry
MathsMaths
₹41,848 per year
EMI starts from ₹3,487.34 per month
Select and buy