
Ozone hole means
(a)A large-sized hole in the stratosphere layer
(b)Thinning of the ozone layer at the poles
(c)Small holes scattered in the ozone layer
(d)Thickening of the ozone layer at the poles
Answer
558.6k+ views
Hint: The ozone layer is the most important layer present in the stratosphere as it filters the harmful UV rays of the sun and prevents it from entering the earth’s surface. The ozone hole has occurred due to various atmospheric pollutants and CFCs released into the atmosphere. It is the depletion of the ozone layer.
Complete Answer:
The ozone layer is a film of ozone gas that is present in the stratosphere, that envelops the earth and prevents the penetration of harmful UV rays. However, due to global warming and certain ozone-depleting substances such as CFCs, HCFCs, etc that are used as coolants in refrigerators and air conditioners, the ozone layer is being depleted steadily.
This ozone depletion is seen to a much greater extent in the polar regions where there is extreme thinning of the ozone layer leading to phenomena such as the polar ice caps melting. This phenomenon of thinning of the ozone layer in the polar areas is known as the ozone hole.
So, the correct answer is, “Thinning of the ozone layer at the poles”
Note:
-The depletion of the ozone layer around the globe was first noticed around the 1970s and this destruction of ozone can be due to a number of free radicals such as hydroxyl radical, nitric oxide, chlorine radical, etc.
-The major cause for ozone depletion was however attributed to the ozone-depleting substances such as Chlorofluorocarbons(CFCs) and HCFCs, and halons.
-Accordingly many countries adopted the Montreal Protocol in 1987 to slowly phase out the use of these substances and develop substitutes. The measures established were effective in stabilizing the ozone levels to a great extent.
Complete Answer:
The ozone layer is a film of ozone gas that is present in the stratosphere, that envelops the earth and prevents the penetration of harmful UV rays. However, due to global warming and certain ozone-depleting substances such as CFCs, HCFCs, etc that are used as coolants in refrigerators and air conditioners, the ozone layer is being depleted steadily.
This ozone depletion is seen to a much greater extent in the polar regions where there is extreme thinning of the ozone layer leading to phenomena such as the polar ice caps melting. This phenomenon of thinning of the ozone layer in the polar areas is known as the ozone hole.
So, the correct answer is, “Thinning of the ozone layer at the poles”
Note:
-The depletion of the ozone layer around the globe was first noticed around the 1970s and this destruction of ozone can be due to a number of free radicals such as hydroxyl radical, nitric oxide, chlorine radical, etc.
-The major cause for ozone depletion was however attributed to the ozone-depleting substances such as Chlorofluorocarbons(CFCs) and HCFCs, and halons.
-Accordingly many countries adopted the Montreal Protocol in 1987 to slowly phase out the use of these substances and develop substitutes. The measures established were effective in stabilizing the ozone levels to a great extent.
Recently Updated Pages
A man running at a speed 5 ms is viewed in the side class 12 physics CBSE

State and explain Hardy Weinbergs Principle class 12 biology CBSE

Which of the following statements is wrong a Amnion class 12 biology CBSE

Two Planoconcave lenses 1 and 2 of glass of refractive class 12 physics CBSE

The compound 2 methyl 2 butene on reaction with NaIO4 class 12 chemistry CBSE

Bacterial cell wall is made up of A Cellulose B Hemicellulose class 12 biology CBSE

Trending doubts
What are the major means of transport Explain each class 12 social science CBSE

Which are the Top 10 Largest Countries of the World?

Draw a labelled sketch of the human eye class 12 physics CBSE

Explain sex determination in humans with line diag class 12 biology CBSE

The pH of the pancreatic juice is A 64 B 86 C 120 D class 12 biology CBSE

Give 10 examples of unisexual and bisexual flowers

